About [(2S)-oxiran-2-yl]methyl 3-[hydroxy(oxido)amino]benzenesulfonate
[(2S)-oxiran-2-yl]methyl 3-[hydroxy(oxido)amino]benzenesulfonate (PubChem CID 163856566) has the molecular formula C9H10NO6S-
and a molecular weight of 260.25 g/mol. Its IUPAC name is [(2S)-oxiran-2-yl]methyl 3-[hydroxy(oxido)amino]benzenesulfonate.
Molecular Properties
| Compound Name | [(2S)-oxiran-2-yl]methyl 3-[hydroxy(oxido)amino]benzenesulfonate |
| PubChem CID | 163856566 |
| Molecular Formula | C9H10NO6S- |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | [(2S)-oxiran-2-yl]methyl 3-[hydroxy(oxido)amino]benzenesulfonate |
| SMILES | O=S(=O)(OC[C@@H]1CO1)c1cccc(N([O-])O)c1 |
| InChI | InChI=1S/C9H10NO6S/c11-10(12)7-2-1-3-9(4-7)17(13,14)16-6-8-5-15-8/h1-4,8,11H,5-6H2/q-1/t8-/m0/s1 |
| InChIKey | VBOKFXTXOOTKQP-QMMMGPOBSA-N |
| XLogP | 0.48 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-oxiran-2-yl]methyl 3-[hydroxy(oxido)amino]benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-oxiran-2-yl]methyl 3-[hydroxy(oxido)amino]benzenesulfonate?
The IUPAC name of [(2S)-oxiran-2-yl]methyl 3-[hydroxy(oxido)amino]benzenesulfonate (CID 163856566) is [(2S)-oxiran-2-yl]methyl 3-[hydroxy(oxido)amino]benzenesulfonate.
What is the SMILES notation for [(2S)-oxiran-2-yl]methyl 3-[hydroxy(oxido)amino]benzenesulfonate?
The canonical SMILES for [(2S)-oxiran-2-yl]methyl 3-[hydroxy(oxido)amino]benzenesulfonate is O=S(=O)(OC[C@@H]1CO1)c1cccc(N([O-])O)c1.
What is the InChIKey of [(2S)-oxiran-2-yl]methyl 3-[hydroxy(oxido)amino]benzenesulfonate?
The InChIKey is VBOKFXTXOOTKQP-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H10NO6S/c11-10(12)7-2-1-3-9(4-7)17(13,14)16-6-8-5-15-8/h1-4,8,11H,5-6H2/q-1/t8-/m0/s1.
What are the key properties of [(2S)-oxiran-2-yl]methyl 3-[hydroxy(oxido)amino]benzenesulfonate?
[(2S)-oxiran-2-yl]methyl 3-[hydroxy(oxido)amino]benzenesulfonate has a molecular weight of 260.25 g/mol, XLogP of 0.48, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-oxiran-2-yl]methyl 3-[hydroxy(oxido)amino]benzenesulfonate is sourced from PubChem (CID 163856566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).