C12H14ClF2NO5 — CID 124767321
(2S,3R,4S,5R)-2-[4-[chloro(difluoro)methoxy]anilino]oxane-3,4,5-triol (PubChem CID 124767321) has the molecular formula C12H14ClF2NO5 and a molecular weight of 325.70 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-[4-[chloro(difluoro)methoxy]anilino]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R)-2-[4-[chloro(difluoro)methoxy]anilino]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 124767321 |
| Molecular Formula | C12H14ClF2NO5 |
| Molecular Weight | 325.70 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | (2S,3R,4S,5R)-2-[4-[chloro(difluoro)methoxy]anilino]oxane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@@H](Nc2ccc(OC(F)(F)Cl)cc2)OC[C@H]1O |
| InChI | InChI=1S/C12H14ClF2NO5/c13-12(14,15)21-7-3-1-6(2-4-7)16-11-10(19)9(18)8(17)5-20-11/h1-4,8-11,16-19H,5H2/t8-,9+,10-,11+/m1/s1 |
| InChIKey | GFWPUCQINPBNKT-YTWAJWBKSA-N |
| XLogP | 0.71 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.70 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|