C11H11ClF2N2OS — CID 705034
(5S)-N-[4-[chloro(difluoro)methoxy]phenyl]-5-methyl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 705034) has the molecular formula C11H11ClF2N2OS and a molecular weight of 292.74 g/mol. Its IUPAC name is (5S)-N-[4-[chloro(difluoro)methoxy]phenyl]-5-methyl-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | (5S)-N-[4-[chloro(difluoro)methoxy]phenyl]-5-methyl-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 705034 |
| Molecular Formula | C11H11ClF2N2OS |
| Molecular Weight | 292.74 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | (5S)-N-[4-[chloro(difluoro)methoxy]phenyl]-5-methyl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | C[C@H]1CN=C(Nc2ccc(OC(F)(F)Cl)cc2)S1 |
| InChI | InChI=1S/C11H11ClF2N2OS/c1-7-6-15-10(18-7)16-8-2-4-9(5-3-8)17-11(12,13)14/h2-5,7H,6H2,1H3,(H,15,16)/t7-/m0/s1 |
| InChIKey | YAZHGLWPZPDNGA-ZETCQYMHSA-N |
| XLogP | 3.76 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.74 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|