C13H14F5NO — CID 177312690
N-(4,4-difluorocyclohexyl)-4-(trifluoromethoxy)aniline (PubChem CID 177312690) has the molecular formula C13H14F5NO and a molecular weight of 295.25 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-4-(trifluoromethoxy)aniline.
| Compound Name | N-(4,4-difluorocyclohexyl)-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 177312690 |
| Molecular Formula | C13H14F5NO |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-4-(trifluoromethoxy)aniline |
| SMILES | FC1(F)CCC(Nc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C13H14F5NO/c14-12(15)7-5-10(6-8-12)19-9-1-3-11(4-2-9)20-13(16,17)18/h1-4,10,19H,5-8H2 |
| InChIKey | UINPTYCCXLSOFW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|