C13H17F2NO — CID 171662901
N-(4,4-difluorocyclohexyl)-3-methoxyaniline (PubChem CID 171662901) has the molecular formula C13H17F2NO and a molecular weight of 241.28 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-3-methoxyaniline.
| Compound Name | N-(4,4-difluorocyclohexyl)-3-methoxyaniline |
|---|---|
| PubChem CID | 171662901 |
| Molecular Formula | C13H17F2NO |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-3-methoxyaniline |
| SMILES | COc1cccc(NC2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C13H17F2NO/c1-17-12-4-2-3-11(9-12)16-10-5-7-13(14,15)8-6-10/h2-4,9-10,16H,5-8H2,1H3 |
| InChIKey | AIWKSIDRNYXDHC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |