C12H17NO2 — CID 93345904
trans-(1S,2S)-2-(3-methoxyanilino)cyclopentan-1-ol (PubChem CID 93345904) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is trans-(1S,2S)-2-(3-methoxyanilino)cyclopentan-1-ol.
| Compound Name | trans-(1S,2S)-2-(3-methoxyanilino)cyclopentan-1-ol |
|---|---|
| PubChem CID | 93345904 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | trans-(1S,2S)-2-(3-methoxyanilino)cyclopentan-1-ol |
| SMILES | COc1cccc(N[C@H]2CCC[C@@H]2O)c1 |
| InChI | InChI=1S/C12H17NO2/c1-15-10-5-2-4-9(8-10)13-11-6-3-7-12(11)14/h2,4-5,8,11-14H,3,6-7H2,1H3/t11-,12-/m0/s1 |
| InChIKey | UKSQVZQOJMECGH-RYUDHWBXSA-N |
| XLogP | 2.02 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |