C13H19NO2 — CID 94220643
trans-(1S,2S)-2-[3-(methoxymethyl)anilino]cyclopentan-1-ol (PubChem CID 94220643) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is trans-(1S,2S)-2-[3-(methoxymethyl)anilino]cyclopentan-1-ol.
| Compound Name | trans-(1S,2S)-2-[3-(methoxymethyl)anilino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 94220643 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | trans-(1S,2S)-2-[3-(methoxymethyl)anilino]cyclopentan-1-ol |
| SMILES | COCc1cccc(N[C@H]2CCC[C@@H]2O)c1 |
| InChI | InChI=1S/C13H19NO2/c1-16-9-10-4-2-5-11(8-10)14-12-6-3-7-13(12)15/h2,4-5,8,12-15H,3,6-7,9H2,1H3/t12-,13-/m0/s1 |
| InChIKey | ZLIHBMGCKQXHRX-STQMWFEESA-N |
| XLogP | 2.16 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |