C11H14ClNO — CID 167050048
(1S)-2-(3-chloroanilino)cyclopentan-1-ol (PubChem CID 167050048) has the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. Its IUPAC name is (1S)-2-(3-chloroanilino)cyclopentan-1-ol.
| Compound Name | (1S)-2-(3-chloroanilino)cyclopentan-1-ol |
|---|---|
| PubChem CID | 167050048 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | (1S)-2-(3-chloroanilino)cyclopentan-1-ol |
| SMILES | O[C@H]1CCCC1Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H14ClNO/c12-8-3-1-4-9(7-8)13-10-5-2-6-11(10)14/h1,3-4,7,10-11,13-14H,2,5-6H2/t10?,11-/m0/s1 |
| InChIKey | MJKJCIXRMZZKJX-DTIOYNMSSA-N |
| XLogP | 2.67 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |