C11H13Cl2NO — CID 102732904
trans-(1S,2S)-2-(2,5-dichloroanilino)cyclopentan-1-ol (PubChem CID 102732904) has the molecular formula C11H13Cl2NO and a molecular weight of 246.14 g/mol. Its IUPAC name is trans-(1S,2S)-2-(2,5-dichloroanilino)cyclopentan-1-ol.
| Compound Name | trans-(1S,2S)-2-(2,5-dichloroanilino)cyclopentan-1-ol |
|---|---|
| PubChem CID | 102732904 |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | trans-(1S,2S)-2-(2,5-dichloroanilino)cyclopentan-1-ol |
| SMILES | O[C@H]1CCC[C@@H]1Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H13Cl2NO/c12-7-4-5-8(13)10(6-7)14-9-2-1-3-11(9)15/h4-6,9,11,14-15H,1-3H2/t9-,11-/m0/s1 |
| InChIKey | LPQXYVQXIXJWAU-ONGXEEELSA-N |
| XLogP | 3.32 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |