C16H22N2O — CID 55114661
2-[3-(methoxymethyl)anilino]cycloheptane-1-carbonitrile (PubChem CID 55114661) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-[3-(methoxymethyl)anilino]cycloheptane-1-carbonitrile.
| Compound Name | 2-[3-(methoxymethyl)anilino]cycloheptane-1-carbonitrile |
|---|---|
| PubChem CID | 55114661 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2-[3-(methoxymethyl)anilino]cycloheptane-1-carbonitrile |
| SMILES | COCc1cccc(NC2CCCCCC2C#N)c1 |
| InChI | InChI=1S/C16H22N2O/c1-19-12-13-6-5-8-15(10-13)18-16-9-4-2-3-7-14(16)11-17/h5-6,8,10,14,16,18H,2-4,7,9,12H2,1H3 |
| InChIKey | YWEMHWSCFFEIEG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |