C13H19NOS — CID 102730841
trans-(1R,2R)-2-(3-methylsulfanylanilino)cyclohexan-1-ol (PubChem CID 102730841) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is trans-(1R,2R)-2-(3-methylsulfanylanilino)cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-(3-methylsulfanylanilino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102730841 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | trans-(1R,2R)-2-(3-methylsulfanylanilino)cyclohexan-1-ol |
| SMILES | CSc1cccc(N[C@@H]2CCCC[C@H]2O)c1 |
| InChI | InChI=1S/C13H19NOS/c1-16-11-6-4-5-10(9-11)14-12-7-2-3-8-13(12)15/h4-6,9,12-15H,2-3,7-8H2,1H3/t12-,13-/m1/s1 |
| InChIKey | PLTVSSZBLRRSBT-CHWSQXEVSA-N |
| XLogP | 3.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |