C17H17F4N3O — CID 133372597
N-(3-methoxyphenyl)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)piperidin-4-amine (PubChem CID 133372597) has the molecular formula C17H17F4N3O and a molecular weight of 355.34 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)piperidin-4-amine.
| Compound Name | N-(3-methoxyphenyl)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)piperidin-4-amine |
|---|---|
| PubChem CID | 133372597 |
| Molecular Formula | C17H17F4N3O |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | N-(3-methoxyphenyl)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)piperidin-4-amine |
| SMILES | COc1cccc(NC2CCN(c3c(F)c(F)nc(F)c3F)CC2)c1 |
| InChI | InChI=1S/C17H17F4N3O/c1-25-12-4-2-3-11(9-12)22-10-5-7-24(8-6-10)15-13(18)16(20)23-17(21)14(15)19/h2-4,9-10,22H,5-8H2,1H3 |
| InChIKey | OFLIVLCOTRTFFX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|