C17H15F4N3O2 — CID 133372898
1-(3-methoxyphenyl)-3-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]piperidin-2-one (PubChem CID 133372898) has the molecular formula C17H15F4N3O2 and a molecular weight of 369.32 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]piperidin-2-one.
| Compound Name | 1-(3-methoxyphenyl)-3-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]piperidin-2-one |
|---|---|
| PubChem CID | 133372898 |
| Molecular Formula | C17H15F4N3O2 |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]piperidin-2-one |
| SMILES | COc1cccc(N2CCCC(Nc3c(F)c(F)nc(F)c3F)C2=O)c1 |
| InChI | InChI=1S/C17H15F4N3O2/c1-26-10-5-2-4-9(8-10)24-7-3-6-11(17(24)25)22-14-12(18)15(20)23-16(21)13(14)19/h2,4-5,8,11H,3,6-7H2,1H3,(H,22,23) |
| InChIKey | LUXAMATXMPIROD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|