C19H21FN2O — CID 138042379
1-(3-fluorophenyl)-3-[[(1S)-1-phenylethyl]amino]piperidin-2-one (PubChem CID 138042379) has the molecular formula C19H21FN2O and a molecular weight of 312.39 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[[(1S)-1-phenylethyl]amino]piperidin-2-one.
| Compound Name | 1-(3-fluorophenyl)-3-[[(1S)-1-phenylethyl]amino]piperidin-2-one |
|---|---|
| PubChem CID | 138042379 |
| Molecular Formula | C19H21FN2O |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[[(1S)-1-phenylethyl]amino]piperidin-2-one |
| SMILES | C[C@H](NC1CCCN(c2cccc(F)c2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C19H21FN2O/c1-14(15-7-3-2-4-8-15)21-18-11-6-12-22(19(18)23)17-10-5-9-16(20)13-17/h2-5,7-10,13-14,18,21H,6,11-12H2,1H3/t14-,18?/m0/s1 |
| InChIKey | SVNUVVYEWJEVLF-PIVQAISJSA-N |
| XLogP | 3.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |