C18H19FN4O2 — CID 95629087
1-[(3R)-1-(3-fluorophenyl)-2-oxopiperidin-3-yl]-3-(pyridin-4-ylmethyl)urea (PubChem CID 95629087) has the molecular formula C18H19FN4O2 and a molecular weight of 342.37 g/mol. Its IUPAC name is 1-[(3R)-1-(3-fluorophenyl)-2-oxopiperidin-3-yl]-3-(pyridin-4-ylmethyl)urea.
| Compound Name | 1-[(3R)-1-(3-fluorophenyl)-2-oxopiperidin-3-yl]-3-(pyridin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 95629087 |
| Molecular Formula | C18H19FN4O2 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 1-[(3R)-1-(3-fluorophenyl)-2-oxopiperidin-3-yl]-3-(pyridin-4-ylmethyl)urea |
| SMILES | O=C(NCc1ccncc1)N[C@@H]1CCCN(c2cccc(F)c2)C1=O |
| InChI | InChI=1S/C18H19FN4O2/c19-14-3-1-4-15(11-14)23-10-2-5-16(17(23)24)22-18(25)21-12-13-6-8-20-9-7-13/h1,3-4,6-9,11,16H,2,5,10,12H2,(H2,21,22,25)/t16-/m1/s1 |
| InChIKey | DYHABPDSGASJRW-MRXNPFEDSA-N |
| XLogP | 2.22 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |