C16H17N3O2S — CID 71876955
1-(2-oxo-1-phenylpyrrolidin-3-yl)-3-(thiophen-3-ylmethyl)urea (PubChem CID 71876955) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is 1-(2-oxo-1-phenylpyrrolidin-3-yl)-3-(thiophen-3-ylmethyl)urea.
| Compound Name | 1-(2-oxo-1-phenylpyrrolidin-3-yl)-3-(thiophen-3-ylmethyl)urea |
|---|---|
| PubChem CID | 71876955 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 1-(2-oxo-1-phenylpyrrolidin-3-yl)-3-(thiophen-3-ylmethyl)urea |
| SMILES | O=C(NCc1ccsc1)NC1CCN(c2ccccc2)C1=O |
| InChI | InChI=1S/C16H17N3O2S/c20-15-14(6-8-19(15)13-4-2-1-3-5-13)18-16(21)17-10-12-7-9-22-11-12/h1-5,7,9,11,14H,6,8,10H2,(H2,17,18,21) |
| InChIKey | YQXRMTXAZRBPBR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |