C21H25N3O2 — CID 71838762
1-[1-(3,5-dimethylphenyl)-2-oxopyrrolidin-3-yl]-3-(2-phenylethyl)urea (PubChem CID 71838762) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-[1-(3,5-dimethylphenyl)-2-oxopyrrolidin-3-yl]-3-(2-phenylethyl)urea.
| Compound Name | 1-[1-(3,5-dimethylphenyl)-2-oxopyrrolidin-3-yl]-3-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 71838762 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 1-[1-(3,5-dimethylphenyl)-2-oxopyrrolidin-3-yl]-3-(2-phenylethyl)urea |
| SMILES | Cc1cc(C)cc(N2CCC(NC(=O)NCCc3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C21H25N3O2/c1-15-12-16(2)14-18(13-15)24-11-9-19(20(24)25)23-21(26)22-10-8-17-6-4-3-5-7-17/h3-7,12-14,19H,8-11H2,1-2H3,(H2,22,23,26) |
| InChIKey | LGDSAKSOIRXGKN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |