C18H18ClN3O2 — CID 154748467
1-benzyl-3-[1-(2-chlorophenyl)-2-oxopyrrolidin-3-yl]urea (PubChem CID 154748467) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is 1-benzyl-3-[1-(2-chlorophenyl)-2-oxopyrrolidin-3-yl]urea.
| Compound Name | 1-benzyl-3-[1-(2-chlorophenyl)-2-oxopyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 154748467 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 1-benzyl-3-[1-(2-chlorophenyl)-2-oxopyrrolidin-3-yl]urea |
| SMILES | O=C(NCc1ccccc1)NC1CCN(c2ccccc2Cl)C1=O |
| InChI | InChI=1S/C18H18ClN3O2/c19-14-8-4-5-9-16(14)22-11-10-15(17(22)23)21-18(24)20-12-13-6-2-1-3-7-13/h1-9,15H,10-12H2,(H2,20,21,24) |
| InChIKey | MMQQDPNDBJPNIZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |