C14H18ClN3O2 — CID 71994500
1-[1-(2-chlorophenyl)-2-oxopiperidin-3-yl]-3-ethylurea (PubChem CID 71994500) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is 1-[1-(2-chlorophenyl)-2-oxopiperidin-3-yl]-3-ethylurea.
| Compound Name | 1-[1-(2-chlorophenyl)-2-oxopiperidin-3-yl]-3-ethylurea |
|---|---|
| PubChem CID | 71994500 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 1-[1-(2-chlorophenyl)-2-oxopiperidin-3-yl]-3-ethylurea |
| SMILES | CCNC(=O)NC1CCCN(c2ccccc2Cl)C1=O |
| InChI | InChI=1S/C14H18ClN3O2/c1-2-16-14(20)17-11-7-5-9-18(13(11)19)12-8-4-3-6-10(12)15/h3-4,6,8,11H,2,5,7,9H2,1H3,(H2,16,17,20) |
| InChIKey | AGCHOGMMINQOLL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |