C18H24ClN3O3 — CID 119802811
N-[1-(2-chlorophenyl)-2-oxopiperidin-3-yl]-4-methoxypiperidine-4-carboxamide (PubChem CID 119802811) has the molecular formula C18H24ClN3O3 and a molecular weight of 365.86 g/mol. Its IUPAC name is N-[1-(2-chlorophenyl)-2-oxopiperidin-3-yl]-4-methoxypiperidine-4-carboxamide.
| Compound Name | N-[1-(2-chlorophenyl)-2-oxopiperidin-3-yl]-4-methoxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 119802811 |
| Molecular Formula | C18H24ClN3O3 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | N-[1-(2-chlorophenyl)-2-oxopiperidin-3-yl]-4-methoxypiperidine-4-carboxamide |
| SMILES | COC1(C(=O)NC2CCCN(c3ccccc3Cl)C2=O)CCNCC1 |
| InChI | InChI=1S/C18H24ClN3O3/c1-25-18(8-10-20-11-9-18)17(24)21-14-6-4-12-22(16(14)23)15-7-3-2-5-13(15)19/h2-3,5,7,14,20H,4,6,8-12H2,1H3,(H,21,24) |
| InChIKey | VBMGKJJCOBQIKM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |