C17H22ClN3O3 — CID 119798480
N-[1-(4-chlorophenyl)-2-oxopyrrolidin-3-yl]-4-methoxypiperidine-4-carboxamide (PubChem CID 119798480) has the molecular formula C17H22ClN3O3 and a molecular weight of 351.83 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-2-oxopyrrolidin-3-yl]-4-methoxypiperidine-4-carboxamide.
| Compound Name | N-[1-(4-chlorophenyl)-2-oxopyrrolidin-3-yl]-4-methoxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 119798480 |
| Molecular Formula | C17H22ClN3O3 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-[1-(4-chlorophenyl)-2-oxopyrrolidin-3-yl]-4-methoxypiperidine-4-carboxamide |
| SMILES | COC1(C(=O)NC2CCN(c3ccc(Cl)cc3)C2=O)CCNCC1 |
| InChI | InChI=1S/C17H22ClN3O3/c1-24-17(7-9-19-10-8-17)16(23)20-14-6-11-21(15(14)22)13-4-2-12(18)3-5-13/h2-5,14,19H,6-11H2,1H3,(H,20,23) |
| InChIKey | AFOIUSDIFCPLCL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |