C17H24BrN3O2 — CID 119884408
N-[1-(2-bromophenyl)pyrrolidin-3-yl]-4-methoxypiperidine-4-carboxamide (PubChem CID 119884408) has the molecular formula C17H24BrN3O2 and a molecular weight of 382.30 g/mol. Its IUPAC name is N-[1-(2-bromophenyl)pyrrolidin-3-yl]-4-methoxypiperidine-4-carboxamide.
| Compound Name | N-[1-(2-bromophenyl)pyrrolidin-3-yl]-4-methoxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 119884408 |
| Molecular Formula | C17H24BrN3O2 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | N-[1-(2-bromophenyl)pyrrolidin-3-yl]-4-methoxypiperidine-4-carboxamide |
| SMILES | COC1(C(=O)NC2CCN(c3ccccc3Br)C2)CCNCC1 |
| InChI | InChI=1S/C17H24BrN3O2/c1-23-17(7-9-19-10-8-17)16(22)20-13-6-11-21(12-13)15-5-3-2-4-14(15)18/h2-5,13,19H,6-12H2,1H3,(H,20,22) |
| InChIKey | SEZSGRQJHPGVGX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |