C15H19ClN2O4S — CID 136527689
N-[1-(2-chlorophenyl)-2-oxopiperidin-3-yl]-2-methylsulfonylpropanamide (PubChem CID 136527689) has the molecular formula C15H19ClN2O4S and a molecular weight of 358.85 g/mol. Its IUPAC name is N-[1-(2-chlorophenyl)-2-oxopiperidin-3-yl]-2-methylsulfonylpropanamide.
| Compound Name | N-[1-(2-chlorophenyl)-2-oxopiperidin-3-yl]-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 136527689 |
| Molecular Formula | C15H19ClN2O4S |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | N-[1-(2-chlorophenyl)-2-oxopiperidin-3-yl]-2-methylsulfonylpropanamide |
| SMILES | CC(C(=O)NC1CCCN(c2ccccc2Cl)C1=O)S(C)(=O)=O |
| InChI | InChI=1S/C15H19ClN2O4S/c1-10(23(2,21)22)14(19)17-12-7-5-9-18(15(12)20)13-8-4-3-6-11(13)16/h3-4,6,8,10,12H,5,7,9H2,1-2H3,(H,17,19) |
| InChIKey | NXICZSMWJQSBHM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |