C11H12ClNO2 — CID 117014113
1-(2-chlorophenyl)-3-hydroxypiperidin-2-one (PubChem CID 117014113) has the molecular formula C11H12ClNO2 and a molecular weight of 225.68 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-hydroxypiperidin-2-one.
| Compound Name | 1-(2-chlorophenyl)-3-hydroxypiperidin-2-one |
|---|---|
| PubChem CID | 117014113 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 1-(2-chlorophenyl)-3-hydroxypiperidin-2-one |
| SMILES | O=C1C(O)CCCN1c1ccccc1Cl |
| InChI | InChI=1S/C11H12ClNO2/c12-8-4-1-2-5-9(8)13-7-3-6-10(14)11(13)15/h1-2,4-5,10,14H,3,6-7H2 |
| InChIKey | RDNDASPBRRBISQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |