C18H25Cl2N3O3 — CID 120794855
2-amino-N-[1-(2-chlorophenyl)-2-oxopiperidin-3-yl]-2-(oxan-4-yl)acetamide;hydrochloride (PubChem CID 120794855) has the molecular formula C18H25Cl2N3O3 and a molecular weight of 402.32 g/mol. Its IUPAC name is 2-amino-N-[1-(2-chlorophenyl)-2-oxopiperidin-3-yl]-2-(oxan-4-yl)acetamide;hydrochloride.
| Compound Name | 2-amino-N-[1-(2-chlorophenyl)-2-oxopiperidin-3-yl]-2-(oxan-4-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120794855 |
| Molecular Formula | C18H25Cl2N3O3 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-amino-N-[1-(2-chlorophenyl)-2-oxopiperidin-3-yl]-2-(oxan-4-yl)acetamide;hydrochloride |
| SMILES | Cl.NC(C(=O)NC1CCCN(c2ccccc2Cl)C1=O)C1CCOCC1 |
| InChI | InChI=1S/C18H24ClN3O3.ClH/c19-13-4-1-2-6-15(13)22-9-3-5-14(18(22)24)21-17(23)16(20)12-7-10-25-11-8-12;/h1-2,4,6,12,14,16H,3,5,7-11,20H2,(H,21,23);1H |
| InChIKey | BYIMSGOOMXSNGG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |