C19H20N4O3 — CID 136524592
4-[(carbamoylamino)methyl]-N-(2-oxo-1-phenylpyrrolidin-3-yl)benzamide (PubChem CID 136524592) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 4-[(carbamoylamino)methyl]-N-(2-oxo-1-phenylpyrrolidin-3-yl)benzamide.
| Compound Name | 4-[(carbamoylamino)methyl]-N-(2-oxo-1-phenylpyrrolidin-3-yl)benzamide |
|---|---|
| PubChem CID | 136524592 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 4-[(carbamoylamino)methyl]-N-(2-oxo-1-phenylpyrrolidin-3-yl)benzamide |
| SMILES | NC(=O)NCc1ccc(C(=O)NC2CCN(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C19H20N4O3/c20-19(26)21-12-13-6-8-14(9-7-13)17(24)22-16-10-11-23(18(16)25)15-4-2-1-3-5-15/h1-9,16H,10-12H2,(H,22,24)(H3,20,21,26) |
| InChIKey | PPNUAJVIIKZSMJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |