C10H10F4N2O — CID 103536626
2,3,5,6-tetrafluoro-4-(3-methoxypyrrolidin-1-yl)pyridine (PubChem CID 103536626) has the molecular formula C10H10F4N2O and a molecular weight of 250.19 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(3-methoxypyrrolidin-1-yl)pyridine.
| Compound Name | 2,3,5,6-tetrafluoro-4-(3-methoxypyrrolidin-1-yl)pyridine |
|---|---|
| PubChem CID | 103536626 |
| Molecular Formula | C10H10F4N2O |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(3-methoxypyrrolidin-1-yl)pyridine |
| SMILES | COC1CCN(c2c(F)c(F)nc(F)c2F)C1 |
| InChI | InChI=1S/C10H10F4N2O/c1-17-5-2-3-16(4-5)8-6(11)9(13)15-10(14)7(8)12/h5H,2-4H2,1H3 |
| InChIKey | OJILSSXUMKZYJF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|