C14H17F4N3 — CID 133338783
2,3,5,6-tetrafluoro-4-(3-pyrrolidin-1-ylpiperidin-1-yl)pyridine (PubChem CID 133338783) has the molecular formula C14H17F4N3 and a molecular weight of 303.30 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(3-pyrrolidin-1-ylpiperidin-1-yl)pyridine.
| Compound Name | 2,3,5,6-tetrafluoro-4-(3-pyrrolidin-1-ylpiperidin-1-yl)pyridine |
|---|---|
| PubChem CID | 133338783 |
| Molecular Formula | C14H17F4N3 |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(3-pyrrolidin-1-ylpiperidin-1-yl)pyridine |
| SMILES | Fc1nc(F)c(F)c(N2CCCC(N3CCCC3)C2)c1F |
| InChI | InChI=1S/C14H17F4N3/c15-10-12(11(16)14(18)19-13(10)17)21-7-3-4-9(8-21)20-5-1-2-6-20/h9H,1-8H2 |
| InChIKey | QFRQBFSMFRGVRR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|