C8H6F4N2O — CID 130964229
1-(2,3,5,6-tetrafluoro-4-pyridinyl)azetidin-3-ol (PubChem CID 130964229) has the molecular formula C8H6F4N2O and a molecular weight of 222.14 g/mol. Its IUPAC name is 1-(2,3,5,6-tetrafluoro-4-pyridinyl)azetidin-3-ol.
| Compound Name | 1-(2,3,5,6-tetrafluoro-4-pyridinyl)azetidin-3-ol |
|---|---|
| PubChem CID | 130964229 |
| Molecular Formula | C8H6F4N2O |
| Molecular Weight | 222.14 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 1-(2,3,5,6-tetrafluoro-4-pyridinyl)azetidin-3-ol |
| SMILES | OC1CN(c2c(F)c(F)nc(F)c2F)C1 |
| InChI | InChI=1S/C8H6F4N2O/c9-4-6(14-1-3(15)2-14)5(10)8(12)13-7(4)11/h3,15H,1-2H2 |
| InChIKey | ZBVKBZIOQFHJFF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.14 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|