C17H22F4N4O — CID 133371650
1-cyclohexyl-3-[1-(2,3,5,6-tetrafluoro-4-pyridinyl)piperidin-4-yl]urea (PubChem CID 133371650) has the molecular formula C17H22F4N4O and a molecular weight of 374.38 g/mol. Its IUPAC name is 1-cyclohexyl-3-[1-(2,3,5,6-tetrafluoro-4-pyridinyl)piperidin-4-yl]urea.
| Compound Name | 1-cyclohexyl-3-[1-(2,3,5,6-tetrafluoro-4-pyridinyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 133371650 |
| Molecular Formula | C17H22F4N4O |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 1-cyclohexyl-3-[1-(2,3,5,6-tetrafluoro-4-pyridinyl)piperidin-4-yl]urea |
| SMILES | O=C(NC1CCCCC1)NC1CCN(c2c(F)c(F)nc(F)c2F)CC1 |
| InChI | InChI=1S/C17H22F4N4O/c18-12-14(13(19)16(21)24-15(12)20)25-8-6-11(7-9-25)23-17(26)22-10-4-2-1-3-5-10/h10-11H,1-9H2,(H2,22,23,26) |
| InChIKey | HQOHPVFKGMICCZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|