C15H16F5NOS — CID 7467421
N-cycloheptyl-2-(2,3,4,5,6-pentafluorophenyl)sulfanylacetamide (PubChem CID 7467421) has the molecular formula C15H16F5NOS and a molecular weight of 353.36 g/mol. Its IUPAC name is N-cycloheptyl-2-(2,3,4,5,6-pentafluorophenyl)sulfanylacetamide.
| Compound Name | N-cycloheptyl-2-(2,3,4,5,6-pentafluorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 7467421 |
| Molecular Formula | C15H16F5NOS |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | N-cycloheptyl-2-(2,3,4,5,6-pentafluorophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1c(F)c(F)c(F)c(F)c1F)NC1CCCCCC1 |
| InChI | InChI=1S/C15H16F5NOS/c16-10-11(17)13(19)15(14(20)12(10)18)23-7-9(22)21-8-5-3-1-2-4-6-8/h8H,1-7H2,(H,21,22) |
| InChIKey | RMIRDVHJENOJNY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|