C13H15F4N3 — CID 79905316
1-(cyclopropylmethyl)-4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazine (PubChem CID 79905316) has the molecular formula C13H15F4N3 and a molecular weight of 289.28 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazine.
| Compound Name | 1-(cyclopropylmethyl)-4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazine |
|---|---|
| PubChem CID | 79905316 |
| Molecular Formula | C13H15F4N3 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 1-(cyclopropylmethyl)-4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazine |
| SMILES | Fc1nc(F)c(F)c(N2CCN(CC3CC3)CC2)c1F |
| InChI | InChI=1S/C13H15F4N3/c14-9-11(10(15)13(17)18-12(9)16)20-5-3-19(4-6-20)7-8-1-2-8/h8H,1-7H2 |
| InChIKey | YGUSNSSAKBJNNS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|