C14H19F3N4 — CID 102717810
6-[4-(cyclopropylmethyl)piperazin-1-yl]-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102717810) has the molecular formula C14H19F3N4 and a molecular weight of 300.33 g/mol. Its IUPAC name is 6-[4-(cyclopropylmethyl)piperazin-1-yl]-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-[4-(cyclopropylmethyl)piperazin-1-yl]-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102717810 |
| Molecular Formula | C14H19F3N4 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 6-[4-(cyclopropylmethyl)piperazin-1-yl]-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | Nc1cc(C(F)(F)F)cc(N2CCN(CC3CC3)CC2)n1 |
| InChI | InChI=1S/C14H19F3N4/c15-14(16,17)11-7-12(18)19-13(8-11)21-5-3-20(4-6-21)9-10-1-2-10/h7-8,10H,1-6,9H2,(H2,18,19) |
| InChIKey | JDBRVPRGSUJESZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |