C14H20F3N3 — CID 102718426
6-(4-ethyl-4-methylpiperidin-1-yl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102718426) has the molecular formula C14H20F3N3 and a molecular weight of 287.33 g/mol. Its IUPAC name is 6-(4-ethyl-4-methylpiperidin-1-yl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-(4-ethyl-4-methylpiperidin-1-yl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102718426 |
| Molecular Formula | C14H20F3N3 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 6-(4-ethyl-4-methylpiperidin-1-yl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCC1(C)CCN(c2cc(C(F)(F)F)cc(N)n2)CC1 |
| InChI | InChI=1S/C14H20F3N3/c1-3-13(2)4-6-20(7-5-13)12-9-10(14(15,16)17)8-11(18)19-12/h8-9H,3-7H2,1-2H3,(H2,18,19) |
| InChIKey | YHDDTHNMHVLOSC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |