C12H17F3N4O — CID 102717512
2-[4-[6-amino-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethanol (PubChem CID 102717512) has the molecular formula C12H17F3N4O and a molecular weight of 290.29 g/mol. Its IUPAC name is 2-[4-[6-amino-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[6-amino-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 102717512 |
| Molecular Formula | C12H17F3N4O |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-[4-[6-amino-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethanol |
| SMILES | Nc1cc(C(F)(F)F)cc(N2CCN(CCO)CC2)n1 |
| InChI | InChI=1S/C12H17F3N4O/c13-12(14,15)9-7-10(16)17-11(8-9)19-3-1-18(2-4-19)5-6-20/h7-8,20H,1-6H2,(H2,16,17) |
| InChIKey | NCFWBTPZXXLJKK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |