C11H17F3N6O — CID 114566945
2-[4-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]piperazin-1-yl]ethanol (PubChem CID 114566945) has the molecular formula C11H17F3N6O and a molecular weight of 306.29 g/mol. Its IUPAC name is 2-[4-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 114566945 |
| Molecular Formula | C11H17F3N6O |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 2-[4-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]piperazin-1-yl]ethanol |
| SMILES | NNc1nc(N2CCN(CCO)CC2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H17F3N6O/c12-11(13,14)8-7-9(17-10(16-8)18-15)20-3-1-19(2-4-20)5-6-21/h7,21H,1-6,15H2,(H,16,17,18) |
| InChIKey | NBQHOFYJUHBJTO-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|