C12H18F3N5O — CID 106839962
1-[1-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]ethanol (PubChem CID 106839962) has the molecular formula C12H18F3N5O and a molecular weight of 305.30 g/mol. Its IUPAC name is 1-[1-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]ethanol.
| Compound Name | 1-[1-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]ethanol |
|---|---|
| PubChem CID | 106839962 |
| Molecular Formula | C12H18F3N5O |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 1-[1-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]ethanol |
| SMILES | CC(O)C1CCN(c2cc(C(F)(F)F)nc(NN)n2)CC1 |
| InChI | InChI=1S/C12H18F3N5O/c1-7(21)8-2-4-20(5-3-8)10-6-9(12(13,14)15)17-11(18-10)19-16/h6-8,21H,2-5,16H2,1H3,(H,17,18,19) |
| InChIKey | AWNQSYDXQPPXQP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|