C12H17F3N4O — CID 106839876
1-[1-[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]ethanol (PubChem CID 106839876) has the molecular formula C12H17F3N4O and a molecular weight of 290.29 g/mol. Its IUPAC name is 1-[1-[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]ethanol.
| Compound Name | 1-[1-[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]ethanol |
|---|---|
| PubChem CID | 106839876 |
| Molecular Formula | C12H17F3N4O |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 1-[1-[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]ethanol |
| SMILES | CC(O)C1CCN(c2cc(N)nc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C12H17F3N4O/c1-7(20)8-2-4-19(5-3-8)10-6-9(16)17-11(18-10)12(13,14)15/h6-8,20H,2-5H2,1H3,(H2,16,17,18) |
| InChIKey | VFZCLGQIUQIWBB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |