C9H11F3N4 — CID 106770242
6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106770242) has the molecular formula C9H11F3N4 and a molecular weight of 232.21 g/mol. Its IUPAC name is 6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106770242 |
| Molecular Formula | C9H11F3N4 |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 6-pyrrolidin-1-yl-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | Nc1cc(N2CCCC2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H11F3N4/c10-9(11,12)8-14-6(13)5-7(15-8)16-3-1-2-4-16/h5H,1-4H2,(H2,13,14,15) |
| InChIKey | COMPHZRVBKDIMW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |