C8H13N3OS — CID 65275177
1-(3-propyl-1,2,4-thiadiazol-5-yl)azetidin-3-ol (PubChem CID 65275177) has the molecular formula C8H13N3OS and a molecular weight of 199.28 g/mol. Its IUPAC name is 1-(3-propyl-1,2,4-thiadiazol-5-yl)azetidin-3-ol.
| Compound Name | 1-(3-propyl-1,2,4-thiadiazol-5-yl)azetidin-3-ol |
|---|---|
| PubChem CID | 65275177 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 1-(3-propyl-1,2,4-thiadiazol-5-yl)azetidin-3-ol |
| SMILES | CCCc1nsc(N2CC(O)C2)n1 |
| InChI | InChI=1S/C8H13N3OS/c1-2-3-7-9-8(13-10-7)11-4-6(12)5-11/h6,12H,2-5H2,1H3 |
| InChIKey | KPIQFCPFTBVSIS-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |