C10H18N4S — CID 65271904
5-(3-methylpiperazin-1-yl)-3-propyl-1,2,4-thiadiazole (PubChem CID 65271904) has the molecular formula C10H18N4S and a molecular weight of 226.35 g/mol. Its IUPAC name is 5-(3-methylpiperazin-1-yl)-3-propyl-1,2,4-thiadiazole.
| Compound Name | 5-(3-methylpiperazin-1-yl)-3-propyl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 65271904 |
| Molecular Formula | C10H18N4S |
| Molecular Weight | 226.35 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 5-(3-methylpiperazin-1-yl)-3-propyl-1,2,4-thiadiazole |
| SMILES | CCCc1nsc(N2CCNC(C)C2)n1 |
| InChI | InChI=1S/C10H18N4S/c1-3-4-9-12-10(15-13-9)14-6-5-11-8(2)7-14/h8,11H,3-7H2,1-2H3 |
| InChIKey | DYBWWVAPUAKAMO-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |