C11H19N5S2 — CID 65272500
2-[4-(3-propyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]ethanethioamide (PubChem CID 65272500) has the molecular formula C11H19N5S2 and a molecular weight of 285.44 g/mol. Its IUPAC name is 2-[4-(3-propyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]ethanethioamide.
| Compound Name | 2-[4-(3-propyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]ethanethioamide |
|---|---|
| PubChem CID | 65272500 |
| Molecular Formula | C11H19N5S2 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-[4-(3-propyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]ethanethioamide |
| SMILES | CCCc1nsc(N2CCN(CC(N)=S)CC2)n1 |
| InChI | InChI=1S/C11H19N5S2/c1-2-3-10-13-11(18-14-10)16-6-4-15(5-7-16)8-9(12)17/h2-8H2,1H3,(H2,12,17) |
| InChIKey | WWWAJSMIEKDQLH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|