About 4-methyl-1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-4-ol
4-methyl-1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-4-ol (PubChem CID 81114967) has the molecular formula C11H19N3OS
and a molecular weight of 241.36 g/mol. Its IUPAC name is 4-methyl-1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-4-ol.
Molecular Properties
| Compound Name | 4-methyl-1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-4-ol |
| PubChem CID | 81114967 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 4-methyl-1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-4-ol |
| SMILES | CCCc1nsc(N2CCC(C)(O)CC2)n1 |
| InChI | InChI=1S/C11H19N3OS/c1-3-4-9-12-10(16-13-9)14-7-5-11(2,15)6-8-14/h15H,3-8H2,1-2H3 |
| InChIKey | VUJHKVKHLOIOAM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methyl-1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-4-ol?
The IUPAC name of 4-methyl-1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-4-ol (CID 81114967) is 4-methyl-1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-4-ol.
What is the SMILES notation for 4-methyl-1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-4-ol?
The canonical SMILES for 4-methyl-1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-4-ol is CCCc1nsc(N2CCC(C)(O)CC2)n1.
What is the InChIKey of 4-methyl-1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-4-ol?
The InChIKey is VUJHKVKHLOIOAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3OS/c1-3-4-9-12-10(16-13-9)14-7-5-11(2,15)6-8-14/h15H,3-8H2,1-2H3.
What are the key properties of 4-methyl-1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-4-ol?
4-methyl-1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-4-ol has a molecular weight of 241.36 g/mol, XLogP of 1.84, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-(3-propyl-1,2,4-thiadiazol-5-yl)piperidin-4-ol is sourced from PubChem (CID 81114967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).