About 1-(4-amino-6-propyl-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol
1-(4-amino-6-propyl-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol (PubChem CID 112746292) has the molecular formula C12H21N5O
and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-(4-amino-6-propyl-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol.
Molecular Properties
| Compound Name | 1-(4-amino-6-propyl-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol |
| PubChem CID | 112746292 |
| Molecular Formula | C12H21N5O |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 1-(4-amino-6-propyl-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol |
| SMILES | CCCc1nc(N)nc(N2CCC(C)(O)CC2)n1 |
| InChI | InChI=1S/C12H21N5O/c1-3-4-9-14-10(13)16-11(15-9)17-7-5-12(2,18)6-8-17/h18H,3-8H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | IIKJYRKHCWADGA-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(4-amino-6-propyl-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-6-propyl-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol?
The IUPAC name of 1-(4-amino-6-propyl-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol (CID 112746292) is 1-(4-amino-6-propyl-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol.
What is the SMILES notation for 1-(4-amino-6-propyl-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol?
The canonical SMILES for 1-(4-amino-6-propyl-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol is CCCc1nc(N)nc(N2CCC(C)(O)CC2)n1.
What is the InChIKey of 1-(4-amino-6-propyl-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol?
The InChIKey is IIKJYRKHCWADGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N5O/c1-3-4-9-14-10(13)16-11(15-9)17-7-5-12(2,18)6-8-17/h18H,3-8H2,1-2H3,(H2,13,14,15,16).
What are the key properties of 1-(4-amino-6-propyl-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol?
1-(4-amino-6-propyl-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol has a molecular weight of 251.33 g/mol, XLogP of 0.76, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-6-propyl-1,3,5-triazin-2-yl)-4-methylpiperidin-4-ol is sourced from PubChem (CID 112746292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).