C13H16F4N2O — CID 102745010
2,2,6,6-tetramethyl-4-(2,3,5,6-tetrafluoro-4-pyridinyl)morpholine (PubChem CID 102745010) has the molecular formula C13H16F4N2O and a molecular weight of 292.28 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-(2,3,5,6-tetrafluoro-4-pyridinyl)morpholine.
| Compound Name | 2,2,6,6-tetramethyl-4-(2,3,5,6-tetrafluoro-4-pyridinyl)morpholine |
|---|---|
| PubChem CID | 102745010 |
| Molecular Formula | C13H16F4N2O |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-(2,3,5,6-tetrafluoro-4-pyridinyl)morpholine |
| SMILES | CC1(C)CN(c2c(F)c(F)nc(F)c2F)CC(C)(C)O1 |
| InChI | InChI=1S/C13H16F4N2O/c1-12(2)5-19(6-13(3,4)20-12)9-7(14)10(16)18-11(17)8(9)15/h5-6H2,1-4H3 |
| InChIKey | GIUAPYVTIJUCJB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|