C10H10F4N2 — CID 23441913
2,3,5,6-tetrafluoro-4-piperidin-1-ylpyridine (PubChem CID 23441913) has the molecular formula C10H10F4N2 and a molecular weight of 234.20 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-piperidin-1-ylpyridine.
| Compound Name | 2,3,5,6-tetrafluoro-4-piperidin-1-ylpyridine |
|---|---|
| PubChem CID | 23441913 |
| Molecular Formula | C10H10F4N2 |
| Molecular Weight | 234.20 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-piperidin-1-ylpyridine |
| SMILES | Fc1nc(F)c(F)c(N2CCCCC2)c1F |
| InChI | InChI=1S/C10H10F4N2/c11-6-8(16-4-2-1-3-5-16)7(12)10(14)15-9(6)13/h1-5H2 |
| InChIKey | WHHKPAZFQNVOFJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.20 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|