C9H10F3N3 — CID 11593741
5,7,8-trifluoro-1,4-dimethyl-2,3-dihydropyrido[3,4-b]pyrazine (PubChem CID 11593741) has the molecular formula C9H10F3N3 and a molecular weight of 217.19 g/mol. Its IUPAC name is 5,7,8-trifluoro-1,4-dimethyl-2,3-dihydropyrido[3,4-b]pyrazine.
| Compound Name | 5,7,8-trifluoro-1,4-dimethyl-2,3-dihydropyrido[3,4-b]pyrazine |
|---|---|
| PubChem CID | 11593741 |
| Molecular Formula | C9H10F3N3 |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | 5,7,8-trifluoro-1,4-dimethyl-2,3-dihydropyrido[3,4-b]pyrazine |
| SMILES | CN1CCN(C)c2c(F)c(F)nc(F)c21 |
| InChI | InChI=1S/C9H10F3N3/c1-14-3-4-15(2)7-6(14)5(10)8(11)13-9(7)12/h3-4H2,1-2H3 |
| InChIKey | HAJMFLFLPRSEKK-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|