C13H20F2N4 — CID 11499999
N,N-diethyl-6,7-difluoro-1,4-dimethyl-2,3-dihydropyrido[2,3-b]pyrazin-8-amine (PubChem CID 11499999) has the molecular formula C13H20F2N4 and a molecular weight of 270.33 g/mol. Its IUPAC name is N,N-diethyl-6,7-difluoro-1,4-dimethyl-2,3-dihydropyrido[2,3-b]pyrazin-8-amine.
| Compound Name | N,N-diethyl-6,7-difluoro-1,4-dimethyl-2,3-dihydropyrido[2,3-b]pyrazin-8-amine |
|---|---|
| PubChem CID | 11499999 |
| Molecular Formula | C13H20F2N4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | N,N-diethyl-6,7-difluoro-1,4-dimethyl-2,3-dihydropyrido[2,3-b]pyrazin-8-amine |
| SMILES | CCN(CC)c1c(F)c(F)nc2c1N(C)CCN2C |
| InChI | InChI=1S/C13H20F2N4/c1-5-19(6-2)10-9(14)12(15)16-13-11(10)17(3)7-8-18(13)4/h5-8H2,1-4H3 |
| InChIKey | NLALFEVRSLMXJB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|