C13H8F8N4 — CID 3973534
N,N'-bis(2,3,5,6-tetrafluoro-4-pyridinyl)propane-1,3-diamine (PubChem CID 3973534) has the molecular formula C13H8F8N4 and a molecular weight of 372.22 g/mol. Its IUPAC name is N,N'-bis(2,3,5,6-tetrafluoro-4-pyridinyl)propane-1,3-diamine.
| Compound Name | N,N'-bis(2,3,5,6-tetrafluoro-4-pyridinyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 3973534 |
| Molecular Formula | C13H8F8N4 |
| Molecular Weight | 372.22 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | N,N'-bis(2,3,5,6-tetrafluoro-4-pyridinyl)propane-1,3-diamine |
| SMILES | Fc1nc(F)c(F)c(NCCCNc2c(F)c(F)nc(F)c2F)c1F |
| InChI | InChI=1S/C13H8F8N4/c14-4-8(5(15)11(19)24-10(4)18)22-2-1-3-23-9-6(16)12(20)25-13(21)7(9)17/h1-3H2,(H,22,24)(H,23,25) |
| InChIKey | SXFVOOSWOKCVKQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.22 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|