C14H10F8N4 — CID 132602370
N,N'-bis(2,3,5,6-tetrafluoro-4-pyridinyl)butane-1,4-diamine (PubChem CID 132602370) has the molecular formula C14H10F8N4 and a molecular weight of 386.25 g/mol. Its IUPAC name is N,N'-bis(2,3,5,6-tetrafluoro-4-pyridinyl)butane-1,4-diamine.
| Compound Name | N,N'-bis(2,3,5,6-tetrafluoro-4-pyridinyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 132602370 |
| Molecular Formula | C14H10F8N4 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | N,N'-bis(2,3,5,6-tetrafluoro-4-pyridinyl)butane-1,4-diamine |
| SMILES | Fc1nc(F)c(F)c(NCCCCNc2c(F)c(F)nc(F)c2F)c1F |
| InChI | InChI=1S/C14H10F8N4/c15-5-9(6(16)12(20)25-11(5)19)23-3-1-2-4-24-10-7(17)13(21)26-14(22)8(10)18/h1-4H2,(H,23,25)(H,24,26) |
| InChIKey | WIQOACNMMXONQH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|